Structure of PDB 5i59 Chain A Binding Site BS02 |
|
|
Ligand ID | 67Q |
InChI | InChI=1S/C18H19F2N5O3S2/c1-10-16(9-24-30(27,28)13-3-4-14(19)15(20)5-13)22-8-17(25-10)18(26)23-7-12-6-21-11(2)29-12/h3-5,8,24,29H,6-7,9H2,1-2H3,(H,23,26) |
InChIKey | HFAAVRVHIWBOKK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c1(c(C)nc(cn1)C(=O)NCC=2CN=C(C)S=2)CNS(c3cc(c(cc3)F)F)(=O)=O | CACTVS 3.385 | CC1=NCC(=[SH]1)CNC(=O)c2cnc(CN[S](=O)(=O)c3ccc(F)c(F)c3)c(C)n2 | OpenEye OEToolkits 2.0.4 | Cc1c(ncc(n1)C(=O)NCC2=SC(=NC2)C)CNS(=O)(=O)c3ccc(c(c3)F)F |
|
Formula | C18 H19 F2 N5 O3 S2 |
Name | 5-({[(3,4-difluorophenyl)sulfonyl]amino}methyl)-6-methyl-N-[(2-methyl-4H-1lambda~4~,3-thiazol-5-yl)methyl]pyrazine-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 5i59 Chain B Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|