Structure of PDB 5hsr Chain A Binding Site BS02 |
|
|
Ligand ID | 63Y |
InChI | InChI=1S/C13H9F3N4S2/c1-4-7-10(17)19-13(18)20-11(7)22-12(4)21-6-3-2-5(14)8(15)9(6)16/h2-3H,1H3,(H4,17,18,19,20) |
InChIKey | HOYROOKWEBIDCA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1c(Sc2ccc(F)c(F)c2F)sc3nc(N)nc(N)c13 | OpenEye OEToolkits 2.0.4 | Cc1c2c(nc(nc2sc1Sc3ccc(c(c3F)F)F)N)N | ACDLabs 12.01 | c23sc(Sc1c(F)c(F)c(F)cc1)c(c2c(N)nc(n3)N)C |
|
Formula | C13 H9 F3 N4 S2 |
Name | 5-methyl-6-[(2,3,4-trifluorophenyl)sulfanyl]thieno[2,3-d]pyrimidine-2,4-diamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584905229
|
PDB chain | 5hsr Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
L22 E30 |
Catalytic site (residue number reindexed from 1) |
L22 E30 |
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|