Structure of PDB 5h19 Chain A Binding Site BS02 |
|
|
Ligand ID | LQF |
InChI | InChI=1S/C22H20N6O/c23-11-19-18-8-9-27(13-16-5-2-1-3-6-16)14-20(18)22-26-25-15-28(22)21(19)24-12-17-7-4-10-29-17/h1-7,10,15,24H,8-9,12-14H2 |
InChIKey | QBTUKQKTXYTWPD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(cc1)CN2CCc3c(c4nncn4c(c3C#N)NCc5ccco5)C2 | CACTVS 3.385 | N#Cc1c2CCN(Cc3ccccc3)Cc2c4nncn4c1NCc5occc5 |
|
Formula | C22 H20 N6 O |
Name | 5-(furan-2-ylmethylamino)-9-(phenylmethyl)-8,10-dihydro-7H-[1,2,4]triazolo[3,4-a][2,7]naphthyridine-6-carbonitrile |
ChEMBL | CHEMBL4096234 |
DrugBank | |
ZINC | ZINC000020676307
|
PDB chain | 5h19 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|