Structure of PDB 5epb Chain A Binding Site BS02 |
|
|
Ligand ID | 5QW |
InChI | InChI=1S/C17H23N3O3S/c1-12(20-5-7-23-8-6-20)11-18-17(22)13-2-3-15-14(10-13)19-16(21)4-9-24-15/h2-3,10,12H,4-9,11H2,1H3,(H,18,22)(H,19,21)/t12-/m0/s1 |
InChIKey | MNYMDWGPOVDYSU-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](CNC(=O)c1ccc2SCCC(=O)Nc2c1)N3CCOCC3 | CACTVS 3.385 | C[C@@H](CNC(=O)c1ccc2SCCC(=O)Nc2c1)N3CCOCC3 | OpenEye OEToolkits 2.0.4 | CC(CNC(=O)c1ccc2c(c1)NC(=O)CCS2)N3CCOCC3 | OpenEye OEToolkits 2.0.4 | C[C@@H](CNC(=O)c1ccc2c(c1)NC(=O)CCS2)N3CCOCC3 |
|
Formula | C17 H23 N3 O3 S |
Name | ~{N}-[(2~{S})-2-morpholin-4-ylpropyl]-4-oxidanylidene-3,5-dihydro-2~{H}-1,5-benzothiazepine-7-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000029957584
|
PDB chain | 5epb Chain A Residue 1202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|