Structure of PDB 5ekm Chain A Binding Site BS02 |
|
|
Ligand ID | TG5 |
InChI | InChI=1S/C12H19N3O3S/c1-2-3-8-14-9-12(16)15-10-4-6-11(7-5-10)19(13,17)18/h4-7,14H,2-3,8-9H2,1H3,(H,15,16)(H2,13,17,18) |
InChIKey | RSJVJFMYAFZYGN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCCNCC(=O)Nc1ccc(cc1)[S](N)(=O)=O | OpenEye OEToolkits 2.0.4 | CCCCNCC(=O)Nc1ccc(cc1)S(=O)(=O)N |
|
Formula | C12 H19 N3 O3 S |
Name | 2-(butylamino)-~{N}-(4-sulfamoylphenyl)ethanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000003426963
|
PDB chain | 5ekm Chain A Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|