Structure of PDB 5eh7 Chain A Binding Site BS02 |
|
|
Ligand ID | 5O5 |
InChI | InChI=1S/C8H6Cl2N4O/c9-6-2-1-5(3-7(6)10)15-4-8-11-13-14-12-8/h1-3H,4H2,(H,11,12,13,14) |
InChIKey | ZOGKJMQMVBATST-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Clc1ccc(OCc2[nH]nnn2)cc1Cl | OpenEye OEToolkits 2.0.4 | c1cc(c(cc1OCc2[nH]nnn2)Cl)Cl |
|
Formula | C8 H6 Cl2 N4 O |
Name | 5-[[3,4-bis(chloranyl)phenoxy]methyl]-1~{H}-1,2,3,4-tetrazole |
ChEMBL | |
DrugBank | |
ZINC | ZINC000041291718
|
PDB chain | 5eh7 Chain A Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|