Structure of PDB 5ede Chain A Binding Site BS02 |
|
|
Ligand ID | 5M6 |
InChI | InChI=1S/C18H18ClN3O2S/c1-11-15-9-16(17(23)20-10-14-3-2-8-24-14)25-18(15)22(21-11)13-6-4-12(19)5-7-13/h4-7,9,14H,2-3,8,10H2,1H3,(H,20,23)/t14-/m1/s1 |
InChIKey | FLUPQHODHFEJEZ-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1nn(c2ccc(Cl)cc2)c3sc(cc13)C(=O)NC[C@H]4CCCO4 | OpenEye OEToolkits 2.0.4 | Cc1c2cc(sc2n(n1)c3ccc(cc3)Cl)C(=O)NCC4CCCO4 | OpenEye OEToolkits 2.0.4 | Cc1c2cc(sc2n(n1)c3ccc(cc3)Cl)C(=O)NC[C@H]4CCCO4 | CACTVS 3.385 | Cc1nn(c2ccc(Cl)cc2)c3sc(cc13)C(=O)NC[CH]4CCCO4 |
|
Formula | C18 H18 Cl N3 O2 S |
Name | 1-(4-chlorophenyl)-3-methyl-~{N}-[[(2~{R})-oxolan-2-yl]methyl]thieno[2,3-c]pyrazole-5-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000003278467
|
PDB chain | 5ede Chain A Residue 804
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.17: 3',5'-cyclic-nucleotide phosphodiesterase. |
|
|
|