Structure of PDB 5ecx Chain A Binding Site BS02 |
|
|
Ligand ID | 5N1 |
InChI | InChI=1S/C22H21N5O2/c1-3-18-16(21(23)27-22(24)26-18)5-4-13(2)17-10-15(14-6-8-25-9-7-14)11-19-20(17)29-12-28-19/h6-11,13H,3,12H2,1-2H3,(H4,23,24,26,27)/t13-/m0/s1 |
InChIKey | NRVDPWMGAWNSHR-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.4 | CCc1c(c(nc(n1)N)N)C#CC(C)c2cc(cc3c2OCO3)c4ccncc4 | OpenEye OEToolkits 2.0.4 | CCc1c(c(nc(n1)N)N)C#C[C@H](C)c2cc(cc3c2OCO3)c4ccncc4 | CACTVS 3.385 | CCc1nc(N)nc(N)c1C#C[CH](C)c2cc(cc3OCOc23)c4ccncc4 | CACTVS 3.385 | CCc1nc(N)nc(N)c1C#C[C@H](C)c2cc(cc3OCOc23)c4ccncc4 |
|
Formula | C22 H21 N5 O2 |
Name | 6-ethyl-5-[(3~{S})-3-(6-pyridin-4-yl-1,3-benzodioxol-4-yl)but-1-ynyl]pyrimidine-2,4-diamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904821
|
PDB chain | 5ecx Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|