Structure of PDB 5die Chain A Binding Site BS02 |
|
|
Ligand ID | 5CJ |
InChI | InChI=1S/C16H19F3O2/c1-16-5-4-8(6-9(16)2-3-12(16)20)10-7-11(17)15(21)14(19)13(10)18/h7-9,12,20-21H,2-6H2,1H3/t8-,9+,12-,16-/m0/s1 |
InChIKey | YBEWPYOAFFTAGI-YFESCLGYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C]12CC[CH](C[CH]1CC[CH]2O)c3cc(F)c(O)c(F)c3F | OpenEye OEToolkits 1.9.2 | C[C@]12CC[C@@H](C[C@H]1CC[C@@H]2O)c3cc(c(c(c3F)F)O)F | ACDLabs 12.01 | CC32CCC(c1cc(c(O)c(F)c1F)F)CC3CCC2O | OpenEye OEToolkits 1.9.2 | CC12CCC(CC1CCC2O)c3cc(c(c(c3F)F)O)F | CACTVS 3.385 | C[C@]12CC[C@@H](C[C@H]1CC[C@@H]2O)c3cc(F)c(O)c(F)c3F |
|
Formula | C16 H19 F3 O2 |
Name | (1S,3aR,5S,7aS)-7a-methyl-5-(2,3,5-trifluoro-4-hydroxyphenyl)octahydro-1H-inden-1-ol |
ChEMBL | CHEMBL1651145 |
DrugBank | |
ZINC | ZINC000066102049
|
PDB chain | 5die Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|