Structure of PDB 5cls Chain A Binding Site BS02 |
|
|
Ligand ID | 52T |
InChI | InChI=1S/C19H26N4O4/c1-12(2)20-18(24)27-15-9-10-19(3,25)17-16(15)21-22-23(17)11-13-5-7-14(26-4)8-6-13/h5-8,12,15,25H,9-11H2,1-4H3,(H,20,24)/t15-,19-/m1/s1 |
InChIKey | CDAJJINZTVFCPA-DNVCBOLYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC(C)NC(=O)OC1CCC(c2c1nnn2Cc3ccc(cc3)OC)(C)O | OpenEye OEToolkits 1.9.2 | CC(C)NC(=O)O[C@@H]1CC[C@@](c2c1nnn2Cc3ccc(cc3)OC)(C)O | ACDLabs 12.01 | C(n2c1c(C(OC(NC(C)C)=O)CCC1(O)C)nn2)c3ccc(cc3)OC | CACTVS 3.385 | COc1ccc(Cn2nnc3[CH](CC[C](C)(O)c23)OC(=O)NC(C)C)cc1 | CACTVS 3.385 | COc1ccc(Cn2nnc3[C@@H](CC[C@@](C)(O)c23)OC(=O)NC(C)C)cc1 |
|
Formula | C19 H26 N4 O4 |
Name | (4R,7R)-7-hydroxy-1-(4-methoxybenzyl)-7-methyl-4,5,6,7-tetrahydro-1H-benzotriazol-4-yl propan-2-ylcarbamate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620303
|
PDB chain | 5cls Chain A Residue 506
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|