Structure of PDB 5c2e Chain A Binding Site BS02 |
|
|
Ligand ID | 4PX |
InChI | InChI=1S/C19H18N4O3/c1-19(2,11-24)23-15-14(21-18(23)26)13-9-6-10-20-16(13)22(17(15)25)12-7-4-3-5-8-12/h3-10,24H,11H2,1-2H3,(H,21,26) |
InChIKey | ZQRNBXXBVMUYDO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | CC(C)(CO)N1C2=C(c3cccnc3N(C2=O)c4ccccc4)NC1=O | CACTVS 3.385 | CC(C)(CO)N1C(=O)NC2=C1C(=O)N(c3ccccc3)c4ncccc24 | ACDLabs 12.01 | n3c2N(c1ccccc1)C(=O)C=4N(C(CO)(C)C)C(=O)NC=4c2ccc3 |
|
Formula | C19 H18 N4 O3 |
Name | 3-(1-hydroxy-2-methylpropan-2-yl)-5-phenyl-3,5-dihydro-1H-imidazo[4,5-c][1,8]naphthyridine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263621355
|
PDB chain | 5c2e Chain A Residue 803
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.17: 3',5'-cyclic-nucleotide phosphodiesterase. |
|
|
|