Structure of PDB 5bvc Chain A Binding Site BS02 |
|
|
Ligand ID | 4PW |
InChI | InChI=1S/C6H10O5/c7-3-2-1-10-6(11-2)5(9)4(3)8/h2-9H,1H2/t2-,3-,4+,5-,6-/m1/s1 |
InChIKey | TWNIBLMWSKIRAT-VFUOTHLCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[C@H]1[C@H](O)[C@H]2CO[C@H](O2)[C@@H]1O | OpenEye OEToolkits 1.9.2 | C1C2C(C(C(C(O1)O2)O)O)O | OpenEye OEToolkits 1.9.2 | C1[C@@H]2[C@H]([C@@H]([C@H]([C@H](O1)O2)O)O)O | ACDLabs 12.01 | OC1C(C2OC(C1O)OC2)O | CACTVS 3.385 | O[CH]1[CH](O)[CH]2CO[CH](O2)[CH]1O |
|
Formula | C6 H10 O5 |
Name | Levoglucosan; (1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
ChEMBL | CHEMBL3138649 |
DrugBank | |
ZINC | ZINC000003881595
|
PDB chain | 5bvc Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.7.1.232: levoglucosan kinase. |
|
|
|