Structure of PDB 5aok Chain A Binding Site BS02 |
|
|
Ligand ID | GOH |
InChI | InChI=1S/C11H10N6O/c1-2-6-17(5-1)11-8(9-13-15-16-14-9)12-10(18-11)7-3-4-7/h1-2,5-7H,3-4H2,(H,13,14,15,16) |
InChIKey | WNHQAZRUEGMEKF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccn(c1)c2c(nc(o2)C3CC3)c4[nH]nnn4 | CACTVS 3.385 | C1CC1c2oc(n3cccc3)c(n2)c4[nH]nnn4 |
|
Formula | C11 H10 N6 O |
Name | 5-[2-cyclopropyl-5-(1H-pyrrol-1-yl)-1,3-oxazol-4-yl]-1H-1,2,3,4-tetrazole |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263621180
|
PDB chain | 5aok Chain A Residue 1292
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|