Structure of PDB 5ajr Chain A Binding Site BS02 |
|
|
Ligand ID | VT1 |
InChI | InChI=1S/C23H16F7N5O2/c24-16-4-7-18(19(25)9-16)21(36,11-35-13-32-33-34-35)23(29,30)20-8-3-15(10-31-20)14-1-5-17(6-2-14)37-12-22(26,27)28/h1-10,13,36H,11-12H2/t21-/m0/s1 |
InChIKey | IDUYJRXRDSPPRC-NRFANRHFSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | O[C@@](Cn1cnnn1)(c2ccc(F)cc2F)C(F)(F)c3ccc(cn3)c4ccc(OCC(F)(F)F)cc4 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1c2ccc(nc2)C(C(Cn3cnnn3)(c4ccc(cc4F)F)O)(F)F)OCC(F)(F)F | CACTVS 3.385 | O[C](Cn1cnnn1)(c2ccc(F)cc2F)C(F)(F)c3ccc(cn3)c4ccc(OCC(F)(F)F)cc4 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1c2ccc(nc2)C([C@](Cn3cnnn3)(c4ccc(cc4F)F)O)(F)F)OCC(F)(F)F | ACDLabs 12.01 | FC(F)(F)COc1ccc(cc1)c2ccc(nc2)C(F)(F)C(O)(c3ccc(F)cc3F)Cn4nnnc4 |
|
Formula | C23 H16 F7 N5 O2 |
Name | (R)-2-(2,4-Difluorophenyl)-1,1-difluoro-3-(1H-tetrazol-1-yl)-1-(5-(4-(2,2,2-trifluoroethoxy)phenyl)pyridin-2-yl)propan-2-ol |
ChEMBL | CHEMBL3311228 |
DrugBank | DB13055 |
ZINC | ZINC000167574450
|
PDB chain | 5ajr Chain A Residue 1480
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S296 |
Catalytic site (residue number reindexed from 1) |
S267 |
Enzyme Commision number |
1.14.14.154: sterol 14alpha-demethylase. |
|
|
|