Structure of PDB 5a1j Chain A Binding Site BS02 |
|
|
Ligand ID | LCM |
InChI | InChI=1S/C18H20N2O6/c21-13-7-3-5-11(15(13)23)17(25)19-9-1-2-10-20-18(26)12-6-4-8-14(22)16(12)24/h3-8,21-24H,1-2,9-10H2,(H,19,25)(H,20,26) |
InChIKey | FBRVRHJYPWFVCL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(c(c(c1)O)O)C(=O)NCCCCNC(=O)c2cccc(c2O)O | ACDLabs 12.01 | O=C(c1cccc(O)c1O)NCCCCNC(=O)c2cccc(O)c2O | CACTVS 3.370 | Oc1cccc(C(=O)NCCCCNC(=O)c2cccc(O)c2O)c1O |
|
Formula | C18 H20 N2 O6 |
Name | N,N'-butane-1,4-diylbis(2,3-dihydroxybenzamide); 4-LICAM |
ChEMBL | CHEMBL3409788 |
DrugBank | |
ZINC | ZINC000038543559
|
PDB chain | 5a1j Chain A Residue 1312
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|