Structure of PDB 4zz2 Chain A Binding Site BS02 |
|
|
Ligand ID | 3YG |
InChI | InChI=1S/C19H21N5O6S/c20-19-23-15-12(17(28)24-19)7-10(21-15)2-1-3-11-6-9(8-31-11)16(27)22-13(18(29)30)4-5-14(25)26/h6-8,13H,1-5H2,(H,22,27)(H,25,26)(H,29,30)(H4,20,21,23,24,28)/t13-/m0/s1 |
InChIKey | RMEHPWHLFJJYTB-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC1=Nc2[nH]c(CCCc3scc(c3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)cc2C(=O)N1 | OpenEye OEToolkits 1.9.2 | c1c(csc1CCCc2cc3c([nH]2)N=C(NC3=O)N)C(=O)N[C@@H](CCC(=O)O)C(=O)O | ACDLabs 12.01 | N=1c3c(C(NC=1N)=O)cc(CCCc2cc(cs2)C(=O)NC(CCC(=O)O)C(O)=O)n3 | OpenEye OEToolkits 1.9.2 | c1c(csc1CCCc2cc3c([nH]2)N=C(NC3=O)N)C(=O)NC(CCC(=O)O)C(=O)O | CACTVS 3.385 | NC1=Nc2[nH]c(CCCc3scc(c3)C(=O)N[CH](CCC(O)=O)C(O)=O)cc2C(=O)N1 |
|
Formula | C19 H21 N5 O6 S |
Name | (S)-2-({5-[3-(2-Amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-6-yl)-propyl]-thiophene-3-carbonyl}-amino)-pentanedioic acid |
ChEMBL | CHEMBL3628346 |
DrugBank | |
ZINC | ZINC000116645807
|
PDB chain | 4zz2 Chain A Residue 1102
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
N913 H915 T942 D951 |
Catalytic site (residue number reindexed from 1) |
N106 H108 T135 D144 |
Enzyme Commision number |
2.1.2.2: phosphoribosylglycinamide formyltransferase 1. 6.3.3.1: phosphoribosylformylglycinamidine cyclo-ligase. 6.3.4.13: phosphoribosylamine--glycine ligase. |
|
|
|