Structure of PDB 4zyy Chain A Binding Site BS02 |
|
|
Ligand ID | 3YC |
InChI | InChI=1S/C20H23N5O6S/c21-20-24-16-13(18(29)25-20)8-11(22-16)3-1-2-4-12-7-10(9-32-12)17(28)23-14(19(30)31)5-6-15(26)27/h7-9,14H,1-6H2,(H,23,28)(H,26,27)(H,30,31)(H4,21,22,24,25,29)/t14-/m0/s1 |
InChIKey | JBVKQLSCSCXKDY-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | N=2c3nc(CCCCc1cc(C(=O)NC(CCC(O)=O)C(O)=O)cs1)cc3C(NC=2N)=O | CACTVS 3.385 | NC1=Nc2[nH]c(CCCCc3scc(c3)C(=O)N[CH](CCC(O)=O)C(O)=O)cc2C(=O)N1 | OpenEye OEToolkits 1.9.2 | c1c(csc1CCCCc2cc3c([nH]2)N=C(NC3=O)N)C(=O)NC(CCC(=O)O)C(=O)O | OpenEye OEToolkits 1.9.2 | c1c(csc1CCCCc2cc3c([nH]2)N=C(NC3=O)N)C(=O)N[C@@H](CCC(=O)O)C(=O)O | CACTVS 3.385 | NC1=Nc2[nH]c(CCCCc3scc(c3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)cc2C(=O)N1 |
|
Formula | C20 H23 N5 O6 S |
Name | (S)-2-({5-[4-(2-Amino-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]-pyrimidin-6-yl)butyl]thiophene-3-carbonyl}amino)pentanedioic acid |
ChEMBL | CHEMBL2158682 |
DrugBank | |
ZINC | ZINC000095575535
|
PDB chain | 4zyy Chain A Residue 1102
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
N913 H915 T942 D951 |
Catalytic site (residue number reindexed from 1) |
N106 H108 T135 D144 |
Enzyme Commision number |
2.1.2.2: phosphoribosylglycinamide formyltransferase 1. 6.3.3.1: phosphoribosylformylglycinamidine cyclo-ligase. 6.3.4.13: phosphoribosylamine--glycine ligase. |
|
|
|