Structure of PDB 4zqo Chain A Binding Site BS02 |
|
|
Ligand ID | Q67 |
InChI | InChI=1S/C21H16Cl2N4O2/c1-12(25-16-4-2-3-15(22)19(16)23)20(28)26-14-5-6-18-17(11-14)27-21(29-18)13-7-9-24-10-8-13/h2-12,25H,1H3,(H,26,28)/t12-/m0/s1 |
InChIKey | IMBVKBZWLRXRAW-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(Nc3cc1c(oc(n1)c2ccncc2)cc3)C(C)Nc4cccc(c4Cl)Cl | CACTVS 3.385 | C[CH](Nc1cccc(Cl)c1Cl)C(=O)Nc2ccc3oc(nc3c2)c4ccncc4 | CACTVS 3.385 | C[C@H](Nc1cccc(Cl)c1Cl)C(=O)Nc2ccc3oc(nc3c2)c4ccncc4 | OpenEye OEToolkits 1.9.2 | CC(C(=O)Nc1ccc2c(c1)nc(o2)c3ccncc3)Nc4cccc(c4Cl)Cl | OpenEye OEToolkits 1.9.2 | C[C@@H](C(=O)Nc1ccc2c(c1)nc(o2)c3ccncc3)Nc4cccc(c4Cl)Cl |
|
Formula | C21 H16 Cl2 N4 O2 |
Name | N~2~-(2,3-dichlorophenyl)-N-[2-(pyridin-4-yl)-1,3-benzoxazol-5-yl]-L-alaninamide |
ChEMBL | CHEMBL2348794 |
DrugBank | |
ZINC | ZINC000095602824
|
PDB chain | 4zqo Chain A Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.205: IMP dehydrogenase. |
|
|
|