Structure of PDB 4zl1 Chain A Binding Site BS02 |
|
|
Ligand ID | 18X |
InChI | InChI=1S/C19H13FN2O3S/c1-25-19(24)14(10-21)18-22(17(23)11-26-18)16-8-7-13(9-15(16)20)12-5-3-2-4-6-12/h2-9H,11H2,1H3/b18-14- |
InChIKey | LPVBNESBSNMJKY-JXAWBTAJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | COC(=O)C(=C1N(C(=O)CS1)c2ccc(cc2F)c3ccccc3)C#N | CACTVS 3.385 | COC(=O)/C(C#N)=C/1SCC(=O)N/1c2ccc(cc2F)c3ccccc3 | CACTVS 3.385 | COC(=O)C(C#N)=C1SCC(=O)N1c2ccc(cc2F)c3ccccc3 | OpenEye OEToolkits 1.9.2 | COC(=O)/C(=C\1/N(C(=O)CS1)c2ccc(cc2F)c3ccccc3)/C#N | ACDLabs 12.01 | C(\C(OC)=O)(C#N)=C1\SCC(N1c2ccc(cc2F)c3ccccc3)=O |
|
Formula | C19 H13 F N2 O3 S |
Name | methyl (2Z)-cyano[3-(3-fluorobiphenyl-4-yl)-4-oxo-1,3-thiazolidin-2-ylidene]acetate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000584904662
|
PDB chain | 4zl1 Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|