Structure of PDB 4zk5 Chain A Binding Site BS02 |
|
|
Ligand ID | 4P4 |
InChI | InChI=1S/C22H20FN5O2/c23-14-3-1-2-13(8-14)18-7-6-16-17(9-25-20(24)19(16)27-18)21(29)26-15-10-28(11-15)22(30)12-4-5-12/h1-3,6-9,12,15H,4-5,10-11H2,(H2,24,25)(H,26,29) |
InChIKey | FYXCIBJXJYBWPX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1ncc(C(=O)NC2CN(C2)C(=O)C3CC3)c4ccc(nc14)c5cccc(F)c5 | ACDLabs 12.01 | c1c(F)cccc1c5nc2c(c(cnc2N)C(NC4CN(C(=O)C3CC3)C4)=O)cc5 | OpenEye OEToolkits 1.9.2 | c1cc(cc(c1)F)c2ccc3c(cnc(c3n2)N)C(=O)NC4CN(C4)C(=O)C5CC5 |
|
Formula | C22 H20 F N5 O2 |
Name | 8-amino-N-[1-(cyclopropylcarbonyl)azetidin-3-yl]-2-(3-fluorophenyl)-1,7-naphthyridine-5-carboxamide; GNE-495 |
ChEMBL | CHEMBL3623138 |
DrugBank | |
ZINC | ZINC000144770252
|
PDB chain | 4zk5 Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|