Structure of PDB 4z1k Chain A Binding Site BS02 |
|
|
Ligand ID | 4KB |
InChI | InChI=1S/C16H16N2O5S/c17-24(22,23)13-3-1-10(2-4-13)16(21)18-6-5-11-7-14(19)15(20)8-12(11)9-18/h1-4,7-8,19-20H,5-6,9H2,(H2,17,22,23) |
InChIKey | IPKFBGPSWRSLEJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | c1cc(ccc1C(=O)N2CCc3cc(c(cc3C2)O)O)S(=O)(=O)N | ACDLabs 12.01 | c1c(c(cc3c1CN(C(c2ccc(cc2)S(=O)(N)=O)=O)CC3)O)O | CACTVS 3.385 | N[S](=O)(=O)c1ccc(cc1)C(=O)N2CCc3cc(O)c(O)cc3C2 |
|
Formula | C16 H16 N2 O5 S |
Name | 4-[(6,7-dihydroxy-3,4-dihydroisoquinolin-2(1H)-yl)carbonyl]benzenesulfonamide |
ChEMBL | CHEMBL3613777 |
DrugBank | |
ZINC | ZINC000263620563
|
PDB chain | 4z1k Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|