Structure of PDB 4y30 Chain A Binding Site BS02 |
|
|
Ligand ID | 49L |
InChI | InChI=1S/C25H38N4O3/c1-26-10-11-29(2)18-21-17-27-28-25(21)20-3-5-22(6-4-20)32-24-15-23(16-24)31-14-9-19-7-12-30-13-8-19/h3-6,17,19,23-24,26H,7-16,18H2,1-2H3,(H,27,28)/t23-,24- |
InChIKey | QMDKVNSQXPVCRD-RQNOJGIXSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNCCN(C)Cc1c[nH]nc1c2ccc(O[CH]3C[CH](C3)OCCC4CCOCC4)cc2 | CACTVS 3.385 | CNCCN(C)Cc1c[nH]nc1c2ccc(O[C@H]3C[C@@H](C3)OCCC4CCOCC4)cc2 | ACDLabs 12.01 | O(CCC1CCOCC1)C4CC(Oc3ccc(c2nncc2CN(CCNC)C)cc3)C4 | OpenEye OEToolkits 1.9.2 | CNCCN(C)Cc1c[nH]nc1c2ccc(cc2)OC3CC(C3)OCCC4CCOCC4 |
|
Formula | C25 H38 N4 O3 |
Name | N,N'-dimethyl-N-({3-[4-({trans-3-[2-(tetrahydro-2H-pyran-4-yl)ethoxy]cyclobutyl}oxy)phenyl]-1H-pyrazol-4-yl}methyl)ethane-1,2-diamine |
ChEMBL | CHEMBL3589039 |
DrugBank | |
ZINC |
|
PDB chain | 4y30 Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|