Structure of PDB 4xt6 Chain A Binding Site BS02 |
|
|
Ligand ID | 44V |
InChI | InChI=1S/C7H11N5O/c1-3-2-9-5-4(10-3)6(13)12-7(8)11-5/h3,10H,2H2,1H3,(H4,8,9,11,12,13)/t3-/m0/s1 |
InChIKey | HWOZEJJVUCALGB-VKHMYHEASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 OpenEye OEToolkits 1.9.2 | C[C@H]1CNC2=C(N1)C(=O)NC(=N2)N | OpenEye OEToolkits 1.9.2 | CC1CNC2=C(N1)C(=O)NC(=N2)N | ACDLabs 12.01 | O=C1C2=C(N=C(N)N1)NCC(N2)C | CACTVS 3.385 | C[CH]1CNC2=C(N1)C(=O)NC(=N2)N |
|
Formula | C7 H11 N5 O |
Name | (6S)-2-amino-6-methyl-5,6,7,8-tetrahydropteridin-4(3H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013508950
|
PDB chain | 4xt6 Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|