Structure of PDB 4x6h Chain A Binding Site BS02 |
|
|
Ligand ID | I37 |
InChI | InChI=1S/C16H19FN4O2/c17-12-10-11(4-5-13(12)19)14(22)21-16(6-2-1-3-7-16)15(23)20-9-8-18/h4-5,10H,1-3,6-7,9,19H2,(H,20,23)(H,21,22) |
InChIKey | NEJGUCSKQVFSJQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(NC1(C(=O)NCC#N)CCCCC1)c2ccc(N)c(F)c2 | OpenEye OEToolkits 1.9.2 | c1cc(c(cc1C(=O)NC2(CCCCC2)C(=O)NCC#N)F)N | CACTVS 3.385 | Nc1ccc(cc1F)C(=O)NC2(CCCCC2)C(=O)NCC#N |
|
Formula | C16 H19 F N4 O2 |
Name | 4-amino-N-{1-[(cyanomethyl)carbamoyl]cyclohexyl}-3-fluorobenzamide |
ChEMBL | CHEMBL3605413 |
DrugBank | |
ZINC | ZINC000263620788
|
PDB chain | 4x6h Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|