Structure of PDB 4w5i Chain A Binding Site BS02 |
|
|
Ligand ID | 3GX |
InChI | InChI=1S/C15H16N2O/c1-17-9-5-8-12-14(17)10-13(16-15(12)18)11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3,(H,16,18) |
InChIKey | DTMHAFMUJHYVGK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C1NC(=CC2=C1CCCN2C)c3ccccc3 | CACTVS 3.385 OpenEye OEToolkits 1.9.2 | CN1CCCC2=C1C=C(NC2=O)c3ccccc3 |
|
Formula | C15 H16 N2 O |
Name | 1-methyl-7-phenyl-2,3,4,6-tetrahydro-1,6-naphthyridin-5(1H)-one |
ChEMBL | CHEMBL3589281 |
DrugBank | |
ZINC | ZINC000146079446
|
PDB chain | 4w5i Chain A Residue 1204
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|