Structure of PDB 4w1v Chain A Binding Site BS02 |
|
|
Ligand ID | 3GS |
InChI | InChI=1S/C16H14FNO5S/c1-22-15(19)12-11-7-24(21)8-18(11)14(13(12)16(20)23-2)9-4-3-5-10(17)6-9/h3-6H,7-8H2,1-2H3/t24-/m1/s1 |
InChIKey | KCIMLJNZZQRAFE-XMMPIXPASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | COC(=O)c1c2C[S](=O)Cn2c(c3cccc(F)c3)c1C(=O)OC | ACDLabs 12.01 | O=S2Cc1c(c(c(n1C2)c3cccc(F)c3)C(=O)OC)C(=O)OC | OpenEye OEToolkits 1.7.6 | COC(=O)c1c2n(c(c1C(=O)OC)c3cccc(c3)F)CS(=O)C2 | CACTVS 3.385 | COC(=O)c1c2C[S@@](=O)Cn2c(c3cccc(F)c3)c1C(=O)OC | OpenEye OEToolkits 1.7.6 | COC(=O)c1c2n(c(c1C(=O)OC)c3cccc(c3)F)C[S@](=O)C2 |
|
Formula | C16 H14 F N O5 S |
Name | dimethyl (2R)-5-(3-fluorophenyl)-1H-pyrrolo[1,2-c][1,3]thiazole-6,7-dicarboxylate 2-oxide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000001383387
|
PDB chain | 4w1v Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|