Structure of PDB 4ufw Chain A Binding Site BS02 |
|
|
Ligand ID | 7Y6 |
InChI | InChI=1S/C21H24ClN3O3/c1-27-17-4-2-3-14(11-17)12-20(23)25-21(26)18-6-5-15(22)13-19(18)28-16-7-9-24-10-8-16/h2-6,11,13,16,24H,7-10,12H2,1H3,(H2,23,25,26) |
InChIKey | LWKDHLRBDHZTMF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | [H]/N=C(\Cc1cccc(c1)OC)/NC(=O)c2ccc(cc2OC3CCNCC3)Cl | CACTVS 3.385 | COc1cccc(CC(=N)NC(=O)c2ccc(Cl)cc2OC3CCNCC3)c1 | ACDLabs 12.01 | Clc3cc(OC1CCNCC1)c(C(=O)NC(=[N@H])Cc2cccc(OC)c2)cc3 | OpenEye OEToolkits 1.9.2 | COc1cccc(c1)CC(=N)NC(=O)c2ccc(cc2OC3CCNCC3)Cl |
|
Formula | C21 H24 Cl N3 O3 |
Name | 4-chloranyl-N-[2-(3-methoxyphenyl)ethanimidoyl]-2-piperidin-4-yloxy-benzamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620724
|
PDB chain | 4ufw Chain A Residue 1411
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|