Structure of PDB 4u0k Chain A Binding Site BS02 |
|
|
Ligand ID | 744 |
InChI | InChI=1S/C18H23ClN2O2/c1-12-7-8-14(19)10-16(12)20-18(23)13-9-17(22)21(11-13)15-5-3-2-4-6-15/h7-8,10,13,15H,2-6,9,11H2,1H3,(H,20,23)/t13-/m0/s1 |
InChIKey | RJWMDETWDDESBP-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | Cc1ccc(cc1NC(=O)[C@H]2CC(=O)N(C2)C3CCCCC3)Cl | ACDLabs 10.04 | Clc1cc(c(cc1)C)NC(=O)C3CC(=O)N(C2CCCCC2)C3 | OpenEye OEToolkits 1.5.0 | Cc1ccc(cc1NC(=O)C2CC(=O)N(C2)C3CCCCC3)Cl | CACTVS 3.341 | Cc1ccc(Cl)cc1NC(=O)[C@@H]2CN(C3CCCCC3)C(=O)C2 | CACTVS 3.341 | Cc1ccc(Cl)cc1NC(=O)[CH]2CN(C3CCCCC3)C(=O)C2 |
|
Formula | C18 H23 Cl N2 O2 |
Name | (3S)-N-(5-CHLORO-2-METHYLPHENYL)-1-CYCLOHEXYL-5-OXOPYRROLIDINE-3-CARBOXAMIDE |
ChEMBL | |
DrugBank | DB07222 |
ZINC | ZINC000051492080
|
PDB chain | 4u0k Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y158 K165 |
Catalytic site (residue number reindexed from 1) |
Y156 K163 |
Enzyme Commision number |
1.3.1.9: enoyl-[acyl-carrier-protein] reductase (NADH). |
|
|
|