Structure of PDB 4u0j Chain A Binding Site BS02 |
|
|
Ligand ID | 566 |
InChI | InChI=1S/C17H22N2O2/c20-16-11-13(12-19(16)15-9-5-2-6-10-15)17(21)18-14-7-3-1-4-8-14/h1,3-4,7-8,13,15H,2,5-6,9-12H2,(H,18,21)/t13-/m0/s1 |
InChIKey | BVUSHGJZBZMDML-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1ccc(cc1)NC(=O)[C@H]2CC(=O)N(C2)C3CCCCC3 | OpenEye OEToolkits 1.5.0 | c1ccc(cc1)NC(=O)C2CC(=O)N(C2)C3CCCCC3 | ACDLabs 10.04 | O=C3N(C1CCCCC1)CC(C(=O)Nc2ccccc2)C3 | CACTVS 3.341 | O=C1C[CH](CN1C2CCCCC2)C(=O)Nc3ccccc3 | CACTVS 3.341 | O=C1C[C@@H](CN1C2CCCCC2)C(=O)Nc3ccccc3 |
|
Formula | C17 H22 N2 O2 |
Name | (3S)-1-CYCLOHEXYL-5-OXO-N-PHENYLPYRROLIDINE-3-CARBOXAMIDE |
ChEMBL | |
DrugBank | DB07155 |
ZINC | ZINC000002943677
|
PDB chain | 4u0j Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y158 K165 |
Catalytic site (residue number reindexed from 1) |
Y157 K164 |
Enzyme Commision number |
1.3.1.9: enoyl-[acyl-carrier-protein] reductase (NADH). |
|
|
|