Structure of PDB 4tqb Chain A Binding Site BS02 |
|
|
Ligand ID | 34K |
InChI | InChI=1S/C18H13BrN4O4S/c19-13-7-5-11(6-8-13)15-10-28-18(20-15)22-21-14(17(24)25)9-12-3-1-2-4-16(12)23(26)27/h1-8,10H,9H2,(H,20,22)(H,24,25)/b21-14+ |
InChIKey | OHRDQFFRIALSLB-KGENOOAVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)C(Cc1ccccc1[N](=O)=O)=NNc2scc(n2)c3ccc(Br)cc3 | ACDLabs 12.01 | O=N(=O)c1ccccc1CC(=N/Nc2nc(cs2)c3ccc(Br)cc3)\C(=O)O | OpenEye OEToolkits 1.9.2 | c1ccc(c(c1)C/C(=N\Nc2nc(cs2)c3ccc(cc3)Br)/C(=O)O)N(=O)=O | OpenEye OEToolkits 1.9.2 | c1ccc(c(c1)CC(=NNc2nc(cs2)c3ccc(cc3)Br)C(=O)O)N(=O)=O | CACTVS 3.385 | OC(=O)\C(Cc1ccccc1[N](=O)=O)=N\Nc2scc(n2)c3ccc(Br)cc3 |
|
Formula | C18 H13 Br N4 O4 S |
Name | (2E)-2-{2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]hydrazinylidene}-3-(2-nitrophenyl)propanoic acid |
ChEMBL | CHEMBL3310364 |
DrugBank | |
ZINC | ZINC000098208392
|
PDB chain | 4tqb Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|