Structure of PDB 4tos Chain A Binding Site BS02 |
|
|
|
| Ligand ID | 355 |
| InChI | InChI=1S/C33H33N5O4/c1-22-8-7-13-29-35-26(18-30(39)38(22)29)21-36-28-12-6-5-11-27(28)32(41)37(33(36)42)20-24-14-16-25(17-15-24)31(40)34-19-23-9-3-2-4-10-23/h2-13,18,24-25H,14-17,19-21H2,1H3,(H,34,40)/t24-,25- |
| InChIKey | OYXCGADJIIHPMV-SOAUALDESA-N |
| SMILES | | Software | SMILES |
|---|
| CACTVS 3.385 | CC1=CC=CC2=NC(=CC(=O)N12)CN3C(=O)N(C[CH]4CC[CH](CC4)C(=O)NCc5ccccc5)C(=O)c6ccccc36 | | ACDLabs 12.01 | O=C(NCc1ccccc1)C2CCC(CC2)CN4C(=O)c3c(cccc3)N(C4=O)CC=5N=C6C=CC=C(N6C(=O)C=5)C | | CACTVS 3.385 | CC1=CC=CC2=NC(=CC(=O)N12)CN3C(=O)N(C[C@@H]4CC[C@H](CC4)C(=O)NCc5ccccc5)C(=O)c6ccccc36 | | OpenEye OEToolkits 1.7.6 | CC1=CC=CC2=NC(=CC(=O)N12)CN3c4ccccc4C(=O)N(C3=O)CC5CCC(CC5)C(=O)NCc6ccccc6 |
|
| Formula | C33 H33 N5 O4 |
| Name | trans-N-benzyl-4-({1-[(6-methyl-4-oxo-4H-pyrido[1,2-a]pyrimidin-2-yl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}methyl)cyclohexanecarboxamide |
| ChEMBL | |
| DrugBank | |
| ZINC |
|
| PDB chain | 4tos Chain A Residue 1402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|
|
|
|
|
