Structure of PDB 4rfc Chain A Binding Site BS02 |
|
|
Ligand ID | 3O1 |
InChI | InChI=1S/C15H24N2O5S/c1-15(2,3)22-14(18)17-10-4-5-11-21-12-6-8-13(9-7-12)23(16,19)20/h6-9H,4-5,10-11H2,1-3H3,(H,17,18)(H2,16,19,20) |
InChIKey | ULDQAZFJSXNRJO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(N)c1ccc(OCCCCNC(=O)OC(C)(C)C)cc1 | CACTVS 3.385 | CC(C)(C)OC(=O)NCCCCOc1ccc(cc1)[S](N)(=O)=O | OpenEye OEToolkits 1.7.6 | CC(C)(C)OC(=O)NCCCCOc1ccc(cc1)S(=O)(=O)N |
|
Formula | C15 H24 N2 O5 S |
Name | tert-butyl 4-(4-sulfamoylphenoxy)butylcarbamate; tert-butyl 6-(4-sulfamoylphenoxy)hexylcarbamate |
ChEMBL | CHEMBL3359166 |
DrugBank | |
ZINC | ZINC000215713355
|
PDB chain | 4rfc Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|