Structure of PDB 4qx4 Chain A Binding Site BS02 |
|
|
Ligand ID | 3E2 |
InChI | InChI=1S/C11H8N4O2S/c16-8(17)5-15-7-4-2-1-3-6(7)9-10(15)12-11(18)14-13-9/h1-4H,5H2,(H,16,17)(H,12,14,18) |
InChIKey | LCMDWJXBUZDEKA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)C3=NNC(=S)N=C3N2CC(=O)O | ACDLabs 12.01 | O=C(O)CN2c1c(cccc1)C3=NNC(=S)N=C23 | CACTVS 3.385 | OC(=O)CN1c2ccccc2C3=NNC(=S)N=C13 |
|
Formula | C11 H8 N4 O2 S |
Name | (3-thioxo-2,3-dihydro-5H-[1,2,4]triazino[5,6-b]indol-5-yl)acetic acid |
ChEMBL | CHEMBL1405739 |
DrugBank | |
ZINC | ZINC000017744184
|
PDB chain | 4qx4 Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|