Structure of PDB 4qsb Chain A Binding Site BS02 |
|
|
Ligand ID | EWY |
InChI | InChI=1S/C13H13N3O4S2/c1-8-5-12(18)16-13(15-8)21-7-11(17)9-3-2-4-10(6-9)22(14,19)20/h2-6H,7H2,1H3,(H2,14,19,20)(H,15,16,18) |
InChIKey | NYRNFJQJOXIJHL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C2C=C(N=C(SCC(=O)c1cccc(c1)S(=O)(=O)N)N2)C | OpenEye OEToolkits 1.7.6 | CC1=CC(=O)NC(=N1)SCC(=O)c2cccc(c2)S(=O)(=O)N | CACTVS 3.385 | CC1=CC(=O)NC(=N1)SCC(=O)c2cccc(c2)[S](N)(=O)=O |
|
Formula | C13 H13 N3 O4 S2 |
Name | 3-{[(4-methyl-6-oxo-1,6-dihydropyrimidin-2-yl)sulfanyl]acetyl}benzenesulfonamide |
ChEMBL | CHEMBL2443195 |
DrugBank | |
ZINC | ZINC000096940232
|
PDB chain | 4qsb Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|