Structure of PDB 4q8v Chain A Binding Site BS02 |
|
|
Ligand ID | 2YX |
InChI | InChI=1S/C18H15N7O/c19-9-11-3-1-10(2-4-11)5-6-21-18-23-14-7-12-13(8-15(14)24-18)22-17(20)25-16(12)26/h1-4,7-8H,5-6H2,(H2,21,23,24)(H3,20,22,25,26) |
InChIKey | NYFZULJQMISTPE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC1=Nc2cc3nc(NCCc4ccc(cc4)C#N)[nH]c3cc2C(=O)N1 | ACDLabs 12.01 | N#Cc1ccc(cc1)CCNc2nc4c(n2)cc3c(N=C(N)NC3=O)c4 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1CCNc2[nH]c3cc4c(cc3n2)N=C(NC4=O)N)C#N |
|
Formula | C18 H15 N7 O |
Name | 4-{2-[(6-amino-8-oxo-7,8-dihydro-1H-imidazo[4,5-g]quinazolin-2-yl)amino]ethyl}benzonitrile |
ChEMBL | CHEMBL4483739 |
DrugBank | |
ZINC | ZINC000230498210
|
PDB chain | 4q8v Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|