Structure of PDB 4q8q Chain A Binding Site BS02 |
|
|
Ligand ID | CKR |
InChI | InChI=1S/C15H19N7O2/c16-14-18-10-8-12-11(7-9(10)13(23)21-14)19-15(20-12)17-1-2-22-3-5-24-6-4-22/h7-8H,1-6H2,(H2,17,19,20)(H3,16,18,21,23) |
InChIKey | JUHXOBNFTFUPKQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C2NC(=Nc1cc3nc(nc3cc12)NCCN4CCOCC4)N | OpenEye OEToolkits 1.5.0 | c1c2c(cc3c1nc([nH]3)NCCN4CCOCC4)N=C(NC2=O)N | CACTVS 3.341 | NC1=Nc2cc3[nH]c(NCCN4CCOCC4)nc3cc2C(=O)N1 |
|
Formula | C15 H19 N7 O2 |
Name | 6-amino-2-[(2-morpholin-4-ylethyl)amino]-3,7-dihydro-8H-imidazo[4,5-g]quinazolin-8-one; 6-Amino-2-[(2-morpholin-4-ylethyl)amino]-8-oxo-7,8-dihydro-1H-imidazo[4,5-G]quinazolin |
ChEMBL | CHEMBL1231806 |
DrugBank | DB07564 |
ZINC | ZINC000039054426
|
PDB chain | 4q8q Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|