Structure of PDB 4q6e Chain A Binding Site BS02 |
|
|
Ligand ID | KR5 |
InChI | InChI=1S/C14H18N4O3S/c1-10-9-11(2)18(17-10)14(19)7-8-16-12-3-5-13(6-4-12)22(15,20)21/h3-6,9,16H,7-8H2,1-2H3,(H2,15,20,21) |
InChIKey | SQGUOOCGLKRFBU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1cc(n(n1)C(=O)CCNc2ccc(cc2)S(=O)(=O)N)C | ACDLabs 12.01 | O=C(n1nc(cc1C)C)CCNc2ccc(cc2)S(=O)(=O)N | CACTVS 3.385 | Cc1cc(C)n(n1)C(=O)CCNc2ccc(cc2)[S](N)(=O)=O |
|
Formula | C14 H18 N4 O3 S |
Name | 4-{[3-(3,5-dimethyl-1H-pyrazol-1-yl)-3-oxopropyl]amino}benzenesulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000219082714
|
PDB chain | 4q6e Chain A Residue 305
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|