Structure of PDB 4q4s Chain A Binding Site BS02 |
|
|
Ligand ID | S98 |
InChI | InChI=1S/C14H12N6OS/c15-13-17-9-5-11-10(4-8(9)12(21)20-13)18-14(19-11)16-6-7-2-1-3-22-7/h1-5H,6H2,(H2,16,18,19)(H3,15,17,20,21) |
InChIKey | IQKMJWDYMFWZRF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | NC1=Nc2cc3nc(NCc4sccc4)[nH]c3cc2C(=O)N1 | OpenEye OEToolkits 1.5.0 | c1cc(sc1)CNc2[nH]c3cc4c(cc3n2)N=C(NC4=O)N | ACDLabs 10.04 | O=C1c2cc3nc(nc3cc2N=C(N)N1)NCc4sccc4 |
|
Formula | C14 H12 N6 O S |
Name | 6-amino-2-[(thiophen-2-ylmethyl)amino]-1,7-dihydro-8H-imidazo[4,5-g]quinazolin-8-one; 1-(2-thienyl)methyl-2-amino-lin-Benzogunaine |
ChEMBL | CHEMBL1235818 |
DrugBank | DB08514 |
ZINC | ZINC000039714908
|
PDB chain | 4q4s Chain A Residue 406
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|