Structure of PDB 4q4r Chain A Binding Site BS02 |
|
|
Ligand ID | SQO |
InChI | InChI=1S/C15H18N6O2/c22-14-10-7-12-13(8-11(10)17-9-18-14)20-15(19-12)16-1-2-21-3-5-23-6-4-21/h7-9H,1-6H2,(H2,16,19,20)(H,17,18,22) |
InChIKey | IQPSZZDLHUVVGO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C1c2cc3nc(nc3cc2N=CN1)NCCN4CCOCC4 | OpenEye OEToolkits 1.5.0 | c1c2c(cc3c1[nH]c(n3)NCCN4CCOCC4)N=CNC2=O | CACTVS 3.341 | O=C1NC=Nc2cc3nc(NCCN4CCOCC4)[nH]c3cc12 |
|
Formula | C15 H18 N6 O2 |
Name | 2-{[2-(4-Morpholinyl)ethyl]amino}-1,7-dihydro-8H-imidazo[4,5-g]quinazolin-8-one |
ChEMBL | CHEMBL1236036 |
DrugBank | |
ZINC | ZINC000058649958
|
PDB chain | 4q4r Chain A Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|