Structure of PDB 4q4p Chain A Binding Site BS02 |
|
|
Ligand ID | 2YO |
InChI | InChI=1S/C16H20N6O/c23-15-11-8-13-14(9-12(11)18-10-19-15)21-16(20-13)17-4-7-22-5-2-1-3-6-22/h8-10H,1-7H2,(H2,17,20,21)(H,18,19,23) |
InChIKey | NFLZHTAOFKJMSG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1c2c(cc3c1nc([nH]3)NCCN4CCCCC4)NC=NC2=O | CACTVS 3.385 | O=C1N=CNc2cc3[nH]c(NCCN4CCCCC4)nc3cc12 | ACDLabs 12.01 | O=C4N=CNc2c4cc3nc(NCCN1CCCCC1)nc3c2 |
|
Formula | C16 H20 N6 O |
Name | 2-{[2-(piperidin-1-yl)ethyl]amino}-3,5-dihydro-8H-imidazo[4,5-g]quinazolin-8-one |
ChEMBL | CHEMBL3298182 |
DrugBank | |
ZINC | ZINC000098208356
|
PDB chain | 4q4p Chain A Residue 405
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|