Structure of PDB 4pul Chain A Binding Site BS02 |
|
|
Ligand ID | 2WU |
InChI | InChI=1S/C10H10N6O/c1-12-10-14-6-2-4-5(3-7(6)15-10)13-9(11)16-8(4)17/h2-3H,1H3,(H2,12,14,15)(H3,11,13,16,17) |
InChIKey | MRAWGMPHZYODAJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CNc1[nH]c2cc3N=C(N)NC(=O)c3cc2n1 | ACDLabs 12.01 | O=C2c3cc1nc(NC)nc1cc3N=C(N)N2 | OpenEye OEToolkits 1.7.6 | CNc1[nH]c2cc3c(cc2n1)C(=O)NC(=N3)N |
|
Formula | C10 H10 N6 O |
Name | 6-amino-2-(methylamino)-3,7-dihydro-8H-imidazo[4,5-g]quinazolin-8-one |
ChEMBL | CHEMBL3298015 |
DrugBank | |
ZINC | ZINC000087722341
|
PDB chain | 4pul Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|