Structure of PDB 4pps Chain A Binding Site BS02 |
|
|
Ligand ID | ESE |
InChI | InChI=1S/C16H22O2/c1-16-9-8-12(10-13(16)4-7-15(16)18)11-2-5-14(17)6-3-11/h2-3,5-6,12-13,15,17-18H,4,7-10H2,1H3/t12-,13-,15+,16+/m1/s1 |
InChIKey | CEOUGJNTPKXUFS-VDERGJSUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@]12CC[C@H](C[C@H]1CC[C@@H]2O)c3ccc(cc3)O | OpenEye OEToolkits 1.7.6 | CC12CCC(CC1CCC2O)c3ccc(cc3)O | CACTVS 3.385 | C[C]12CC[CH](C[CH]1CC[CH]2O)c3ccc(O)cc3 | CACTVS 3.385 | C[C@]12CC[C@H](C[C@H]1CC[C@@H]2O)c3ccc(O)cc3 | ACDLabs 12.01 | Oc1ccc(cc1)C3CCC2(C(CCC2O)C3)C |
|
Formula | C16 H22 O2 |
Name | (1S,3aR,5R,7aS)-5-(4-hydroxyphenyl)-7a-methyloctahydro-1H-inden-1-ol |
ChEMBL | CHEMBL1651152 |
DrugBank | |
ZINC | ZINC000066111809
|
PDB chain | 4pps Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|