Structure of PDB 4pk5 Chain A Binding Site BS02 |
|
|
Ligand ID | PKJ |
InChI | InChI=1S/C20H16N4O3S2/c1-12-2-4-13(5-3-12)15-9-28-19-22-23-20(24(15)19)29-10-18(25)21-14-6-7-16-17(8-14)27-11-26-16/h2-9H,10-11H2,1H3,(H,21,25) |
InChIKey | XYXNYQAJSYUYNZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ccc(cc1)c2csc3nnc(SCC(=O)Nc4ccc5OCOc5c4)n23 | OpenEye OEToolkits 1.9.2 | Cc1ccc(cc1)c2csc3n2c(nn3)SCC(=O)Nc4ccc5c(c4)OCO5 | ACDLabs 12.01 | O=C(Nc2ccc1OCOc1c2)CSc3nnc4scc(n34)c5ccc(cc5)C |
|
Formula | C20 H16 N4 O3 S2 |
Name | N-(1,3-benzodioxol-5-yl)-2-{[5-(4-methylphenyl)[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl}acetamide |
ChEMBL | CHEMBL3342402 |
DrugBank | |
ZINC | ZINC000000801901
|
PDB chain | 4pk5 Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.13.11.52: indoleamine 2,3-dioxygenase. |
|
|
|