Structure of PDB 4obq Chain A Binding Site BS02 |
|
|
Ligand ID | 2QT |
InChI | InChI=1S/C20H20FN5O/c21-15-7-14(13-3-4-18-17(9-13)20(22)24-12-23-18)8-16(10-15)25-19(27)11-26-5-1-2-6-26/h3-4,7-10,12H,1-2,5-6,11H2,(H,25,27)(H2,22,23,24) |
InChIKey | GDCGMGVDMXRLGC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc2c(cc1c3cc(cc(c3)F)NC(=O)CN4CCCC4)c(ncn2)N | ACDLabs 12.01 | O=C(Nc3cc(c2cc1c(ncnc1cc2)N)cc(F)c3)CN4CCCC4 | CACTVS 3.385 | Nc1ncnc2ccc(cc12)c3cc(F)cc(NC(=O)CN4CCCC4)c3 |
|
Formula | C20 H20 F N5 O |
Name | N-[3-(4-aminoquinazolin-6-yl)-5-fluorophenyl]-2-(pyrrolidin-1-yl)acetamide |
ChEMBL | CHEMBL3262592 |
DrugBank | |
ZINC | ZINC000098208241
|
PDB chain | 4obq Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|