Structure of PDB 4o1l Chain A Binding Site BS02 |
|
|
Ligand ID | HO4 |
InChI | InChI=1S/C13H14N4O4/c1-2-6-3-17(12-8(6)11(14)15-5-16-12)13-10(20)9(19)7(4-18)21-13/h1,3,5,7,9-10,13,18-20H,4H2,(H2,14,15,16)/t7-,9-,10-,13-/m1/s1 |
InChIKey | ANCWCJFYCNNXDR-QYVSTXNMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Nc1ncnc2n(cc(C#C)c12)[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O | ACDLabs 12.01 | C#Cc2c1c(ncnc1n(c2)C3OC(C(O)C3O)CO)N | OpenEye OEToolkits 1.7.6 | C#Cc1cn(c2c1c(ncn2)N)C3C(C(C(O3)CO)O)O | CACTVS 3.385 | Nc1ncnc2n(cc(C#C)c12)[CH]3O[CH](CO)[CH](O)[CH]3O | OpenEye OEToolkits 1.7.6 | C#Cc1cn(c2c1c(ncn2)N)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
|
Formula | C13 H14 N4 O4 |
Name | 5-ethynyl-7-(beta-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
ChEMBL | CHEMBL1814776 |
DrugBank | |
ZINC | ZINC000072106221
|
PDB chain | 4o1l Chain A Residue 404
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|