Structure of PDB 4ntm Chain A Binding Site BS02 |
|
|
Ligand ID | 2K8 |
InChI | InChI=1S/C7H9N5O3/c8-7-11-4-3(5(13)12-7)10-2(1-9-4)6(14)15/h2,10H,1H2,(H,14,15)(H4,8,9,11,12,13)/t2-/m1/s1 |
InChIKey | QSIYONWVWDSRRO-UWTATZPHSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)C2NC1=C(N=C(N)NC1=O)NC2 | OpenEye OEToolkits 1.7.6 | C1[C@@H](NC2=C(N1)N=C(NC2=O)N)C(=O)O | CACTVS 3.385 | NC1=NC2=C(N[C@H](CN2)C(O)=O)C(=O)N1 | OpenEye OEToolkits 1.7.6 | C1C(NC2=C(N1)N=C(NC2=O)N)C(=O)O | CACTVS 3.385 | NC1=NC2=C(N[CH](CN2)C(O)=O)C(=O)N1 |
|
Formula | C7 H9 N5 O3 |
Name | (6R)-2-amino-4-oxo-3,4,5,6,7,8-hexahydropteridine-6-carboxylic acid; 6-carboxy-5,6,7,8-tetrahydropterin |
ChEMBL | |
DrugBank | |
ZINC | ZINC000062238705
|
PDB chain | 4ntm Chain A Residue 202
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
C27 H31 H33 E110 |
Catalytic site (residue number reindexed from 1) |
C21 H25 H27 E104 |
Enzyme Commision number |
4.1.2.50: 6-carboxytetrahydropterin synthase. |
|
|
|