Structure of PDB 4ni1 Chain A Binding Site BS02 |
|
|
Ligand ID | 2JX |
InChI | InChI=1S/C10H9N3O2S/c16-10-11-9(12-13-10)8-5-14-6-3-1-2-4-7(6)15-8/h1-4,8H,5H2,(H2,11,12,13,16)/t8-/m0/s1 |
InChIKey | WDUGNJIRKJHDNF-QMMMGPOBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | S=C1NN=C(N1)[C@@H]2COc3ccccc3O2 | CACTVS 3.385 | S=C1NN=C(N1)[CH]2COc3ccccc3O2 | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)OC[C@H](O2)C3=NNC(=S)N3 | ACDLabs 12.01 | S=C1NN=C(N1)C2Oc3ccccc3OC2 | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)OCC(O2)C3=NNC(=S)N3 |
|
Formula | C10 H9 N3 O2 S |
Name | 5-[(2R)-2,3-dihydro-1,4-benzodioxin-2-yl]-2,4-dihydro-3H-1,2,4-triazole-3-thione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013556312
|
PDB chain | 4ni1 Chain A Residue 203
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|