Structure of PDB 4neu Chain A Binding Site BS02 |
|
|
Ligand ID | Q1A |
InChI | InChI=1S/C23H23N5O2/c1-23(2,3)19-13-20(28-30-19)27-22(29)26-15-9-7-14(8-10-15)16-5-4-6-18-17(16)11-12-25-21(18)24/h4-13H,1-3H3,(H2,24,25)(H2,26,27,28,29) |
InChIKey | SLRYMOUSQMDJPH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(Nc1noc(c1)C(C)(C)C)Nc4ccc(c3c2ccnc(N)c2ccc3)cc4 | OpenEye OEToolkits 1.7.6 | CC(C)(C)c1cc(no1)NC(=O)Nc2ccc(cc2)c3cccc4c3ccnc4N | CACTVS 3.385 | CC(C)(C)c1onc(NC(=O)Nc2ccc(cc2)c3cccc4c(N)nccc34)c1 |
|
Formula | C23 H23 N5 O2 |
Name | 1-[4-(1-aminoisoquinolin-5-yl)phenyl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea |
ChEMBL | CHEMBL3109202 |
DrugBank | |
ZINC | ZINC000095920970
|
PDB chain | 4neu Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|