Structure of PDB 4n3r Chain A Binding Site BS02 |
|
|
Ligand ID | 2GU |
InChI | InChI=1S/C26H22FN5O2/c1-26(2)12-23(33)31-22-11-17(5-6-19(22)26)30-24(34)18-10-15(3-7-20(18)27)14-4-8-21-16(9-14)13-29-25(28)32-21/h3-11,13H,12H2,1-2H3,(H,30,34)(H,31,33)(H2,28,29,32) |
InChIKey | CPSBEKUNRLHZKJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC1(C)CC(=O)Nc2cc(NC(=O)c3cc(ccc3F)c4ccc5nc(N)ncc5c4)ccc12 | OpenEye OEToolkits 1.7.6 | CC1(CC(=O)Nc2c1ccc(c2)NC(=O)c3cc(ccc3F)c4ccc5c(c4)cnc(n5)N)C | ACDLabs 12.01 | Fc3ccc(c2cc1cnc(nc1cc2)N)cc3C(=O)Nc4ccc5c(c4)NC(=O)CC5(C)C |
|
Formula | C26 H22 F N5 O2 |
Name | 5-(2-aminoquinazolin-6-yl)-N-(4,4-dimethyl-2-oxo-1,2,3,4-tetrahydroquinolin-7-yl)-2-fluorobenzamide |
ChEMBL | CHEMBL3099719 |
DrugBank | |
ZINC | ZINC000095921045
|
PDB chain | 4n3r Chain A Residue 1402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|