Structure of PDB 4mdm Chain A Binding Site BS02 |
|
|
Ligand ID | 26E |
InChI | InChI=1S/C3H5B9N2O2S/c13-17(15,16)14-1-3-2-4-6-5(3)9(3)7(2,3)8(2,4)10(4,6)11(5,6,9)12(7,8,9)10/h14H,1H2,(H2,13,15,16) |
InChIKey | VRKHBQSBPLXCRB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | B123B45B167B289B31B823B966B744B622[C@]45C321CNS(=O)(=O)N | CACTVS 3.385 | N[S](=O)(=O)NC[C+]123[B-]45[B-]67[B+]89[C@@]1%10[B]8%11%12[B]69%13[B]47%14[B]25%15[B]3%10%11[B]%12%13%14%15 | OpenEye OEToolkits 1.7.6 | B123B45B167B289B31B823B966B744B622C45C321CNS(=O)(=O)N | CACTVS 3.385 | N[S](=O)(=O)NC[C+]123[B-]45[B-]67[B+]89[C]1%10[B]8%11%12[B]69%13[B]47%14[B]25%15[B]3%10%11[B]%12%13%14%15 |
|
Formula | C3 H5 B9 N2 O2 S |
Name | 7-(sulfamoylamino)methyl-7,8-dicarba-nido-undecaborane |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 4mdm Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|